C17H13Cl3N2O3 — CID 42942844
6,8-dichloro-3-[3-(4-chlorophenoxy)-2-hydroxypropyl]quinazolin-4-one (PubChem CID 42942844) has the molecular formula C17H13Cl3N2O3 and a molecular weight of 399.66 g/mol. Its IUPAC name is 6,8-dichloro-3-[3-(4-chlorophenoxy)-2-hydroxypropyl]quinazolin-4-one.
| Compound Name | 6,8-dichloro-3-[3-(4-chlorophenoxy)-2-hydroxypropyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42942844 |
| Molecular Formula | C17H13Cl3N2O3 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 6,8-dichloro-3-[3-(4-chlorophenoxy)-2-hydroxypropyl]quinazolin-4-one |
| SMILES | O=c1c2cc(Cl)cc(Cl)c2ncn1CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13Cl3N2O3/c18-10-1-3-13(4-2-10)25-8-12(23)7-22-9-21-16-14(17(22)24)5-11(19)6-15(16)20/h1-6,9,12,23H,7-8H2 |
| InChIKey | LMICDQCPULRMBY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |