C23H38N4O — CID 42947528
(4-butylcyclohexyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone (PubChem CID 42947528) has the molecular formula C23H38N4O and a molecular weight of 386.58 g/mol. Its IUPAC name is (4-butylcyclohexyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (4-butylcyclohexyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42947528 |
| Molecular Formula | C23H38N4O |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | (4-butylcyclohexyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
| SMILES | CCCCC1CCC(C(=O)N2CCCC(c3nnc4n3CCCCC4)C2)CC1 |
| InChI | InChI=1S/C23H38N4O/c1-2-3-8-18-11-13-19(14-12-18)23(28)26-15-7-9-20(17-26)22-25-24-21-10-5-4-6-16-27(21)22/h18-20H,2-17H2,1H3 |
| InChIKey | PAAYDXJQAXBLRH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |