C20H31N5O — CID 51111879
2-bicyclo[2.2.1]heptanyl-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 51111879) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | 2-bicyclo[2.2.1]heptanyl-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 51111879 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CC2CCC1C2)N1CCN(Cc2nnc3n2CCCCC3)CC1 |
| InChI | InChI=1S/C20H31N5O/c26-20(17-13-15-5-6-16(17)12-15)24-10-8-23(9-11-24)14-19-22-21-18-4-2-1-3-7-25(18)19/h15-17H,1-14H2 |
| InChIKey | OALLRHATCFYYGZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |