C18H15N5O2S — CID 42948196
N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(1-oxophthalazin-2-yl)acetamide (PubChem CID 42948196) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(1-oxophthalazin-2-yl)acetamide.
| Compound Name | N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(1-oxophthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 42948196 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-2-(1-oxophthalazin-2-yl)acetamide |
| SMILES | Cn1/c(=N/NC(=O)Cn2ncc3ccccc3c2=O)sc2ccccc21 |
| InChI | InChI=1S/C18H15N5O2S/c1-22-14-8-4-5-9-15(14)26-18(22)21-20-16(24)11-23-17(25)13-7-3-2-6-12(13)10-19-23/h2-10H,11H2,1H3,(H,20,24)/b21-18- |
| InChIKey | HYSWCPJAUUSXGR-UZYVYHOESA-N |
| XLogP | 1.58 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|