C11H16F3N3O2 — CID 42948772
3-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 42948772) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is 3-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42948772 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCN1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H16F3N3O2/c12-11(13,14)8-2-1-3-16(7-8)4-5-17-9(18)6-15-10(17)19/h8H,1-7H2,(H,15,19) |
| InChIKey | NGYSCJKUEXBCIQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|