C21H26ClN3O2 — CID 42954314
1-[2-(3-chlorophenyl)ethyl]-3-(2-morpholin-4-yl-1-phenylethyl)urea (PubChem CID 42954314) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-(2-morpholin-4-yl-1-phenylethyl)urea.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-(2-morpholin-4-yl-1-phenylethyl)urea |
|---|---|
| PubChem CID | 42954314 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-(2-morpholin-4-yl-1-phenylethyl)urea |
| SMILES | O=C(NCCc1cccc(Cl)c1)NC(CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C21H26ClN3O2/c22-19-8-4-5-17(15-19)9-10-23-21(26)24-20(18-6-2-1-3-7-18)16-25-11-13-27-14-12-25/h1-8,15,20H,9-14,16H2,(H2,23,24,26) |
| InChIKey | XHTFQSNGQLICBE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |