C25H29N3O3 — CID 112817994
1-(2-morpholin-4-yl-1-phenylethyl)-3-(2-naphthalen-2-yloxyethyl)urea (PubChem CID 112817994) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-(2-morpholin-4-yl-1-phenylethyl)-3-(2-naphthalen-2-yloxyethyl)urea.
| Compound Name | 1-(2-morpholin-4-yl-1-phenylethyl)-3-(2-naphthalen-2-yloxyethyl)urea |
|---|---|
| PubChem CID | 112817994 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-(2-morpholin-4-yl-1-phenylethyl)-3-(2-naphthalen-2-yloxyethyl)urea |
| SMILES | O=C(NCCOc1ccc2ccccc2c1)NC(CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3O3/c29-25(26-12-15-31-23-11-10-20-6-4-5-9-22(20)18-23)27-24(21-7-2-1-3-8-21)19-28-13-16-30-17-14-28/h1-11,18,24H,12-17,19H2,(H2,26,27,29) |
| InChIKey | DHKIMTXVQMJQGO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|