C10H22N2O2S — CID 42955112
1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane (PubChem CID 42955112) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane.
| Compound Name | 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane |
|---|---|
| PubChem CID | 42955112 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane |
| SMILES | CC1CCCC(NS(=O)(=O)N(C)C)C1C |
| InChI | InChI=1S/C10H22N2O2S/c1-8-6-5-7-10(9(8)2)11-15(13,14)12(3)4/h8-11H,5-7H2,1-4H3 |
| InChIKey | WCGMGKPNAPUWDX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |