About 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane
1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane (PubChem CID 42955112) has the molecular formula C10H22N2O2S
and a molecular weight of 234.36 g/mol. Its IUPAC name is 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane |
| PubChem CID | 42955112 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane |
| SMILES | CC1CCCC(NS(=O)(=O)N(C)C)C1C |
| InChI | InChI=1S/C10H22N2O2S/c1-8-6-5-7-10(9(8)2)11-15(13,14)12(3)4/h8-11H,5-7H2,1-4H3 |
| InChIKey | WCGMGKPNAPUWDX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane?
The IUPAC name of 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane (CID 42955112) is 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane.
What is the SMILES notation for 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane?
The canonical SMILES for 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane is CC1CCCC(NS(=O)(=O)N(C)C)C1C.
What is the InChIKey of 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane?
The InChIKey is WCGMGKPNAPUWDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O2S/c1-8-6-5-7-10(9(8)2)11-15(13,14)12(3)4/h8-11H,5-7H2,1-4H3.
What are the key properties of 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane?
1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane has a molecular weight of 234.36 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylsulfamoylamino)-2,3-dimethylcyclohexane is sourced from PubChem (CID 42955112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).