C15H19N3O2 — CID 42956719
1-(cyclopropylmethyl)-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 42956719) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(cyclopropylmethyl)-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42956719 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-(cyclopropylmethyl)-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CC(=O)N(CC2CC2)C1 |
| InChI | InChI=1S/C15H19N3O2/c19-14-6-13(10-18(14)9-11-3-4-11)15(20)17-8-12-2-1-5-16-7-12/h1-2,5,7,11,13H,3-4,6,8-10H2,(H,17,20) |
| InChIKey | AUUDADDCYBWRGO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |