C12H13F3N2O2S — CID 42959299
N-(4-acetamidophenyl)-2-(trifluoromethylsulfanyl)propanamide (PubChem CID 42959299) has the molecular formula C12H13F3N2O2S and a molecular weight of 306.31 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-(trifluoromethylsulfanyl)propanamide.
| Compound Name | N-(4-acetamidophenyl)-2-(trifluoromethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 42959299 |
| Molecular Formula | C12H13F3N2O2S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | N-(4-acetamidophenyl)-2-(trifluoromethylsulfanyl)propanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(C)SC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O2S/c1-7(20-12(13,14)15)11(19)17-10-5-3-9(4-6-10)16-8(2)18/h3-7H,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | JHLKYXKAUZOXMI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |