C10H9F4NOS — CID 169302914
N-(4-fluorophenyl)-2-(trifluoromethylsulfanyl)propanamide (PubChem CID 169302914) has the molecular formula C10H9F4NOS and a molecular weight of 267.25 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(trifluoromethylsulfanyl)propanamide.
| Compound Name | N-(4-fluorophenyl)-2-(trifluoromethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 169302914 |
| Molecular Formula | C10H9F4NOS |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-(4-fluorophenyl)-2-(trifluoromethylsulfanyl)propanamide |
| SMILES | CC(SC(F)(F)F)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C10H9F4NOS/c1-6(17-10(12,13)14)9(16)15-8-4-2-7(11)3-5-8/h2-6H,1H3,(H,15,16) |
| InChIKey | QNAMHAOUXYEQNG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |