C15H15F2NO3 — CID 42961734
N-[1-[3-(difluoromethoxy)phenyl]ethyl]-2-methylfuran-3-carboxamide (PubChem CID 42961734) has the molecular formula C15H15F2NO3 and a molecular weight of 295.29 g/mol. Its IUPAC name is N-[1-[3-(difluoromethoxy)phenyl]ethyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 42961734 |
| Molecular Formula | C15H15F2NO3 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)NC(C)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H15F2NO3/c1-9(18-14(19)13-6-7-20-10(13)2)11-4-3-5-12(8-11)21-15(16)17/h3-9,15H,1-2H3,(H,18,19) |
| InChIKey | CGUGAHUKMDCNBX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |