C23H32N4O2 — CID 42962719
1-(2-ethyl-1-phenylbutyl)-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]urea (PubChem CID 42962719) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 1-(2-ethyl-1-phenylbutyl)-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]urea.
| Compound Name | 1-(2-ethyl-1-phenylbutyl)-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 42962719 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 1-(2-ethyl-1-phenylbutyl)-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]urea |
| SMILES | CCC(CC)C(NC(=O)NCc1ccc(N2CCOCC2)nc1)c1ccccc1 |
| InChI | InChI=1S/C23H32N4O2/c1-3-19(4-2)22(20-8-6-5-7-9-20)26-23(28)25-17-18-10-11-21(24-16-18)27-12-14-29-15-13-27/h5-11,16,19,22H,3-4,12-15,17H2,1-2H3,(H2,25,26,28) |
| InChIKey | NNKXWYSXWPCKLE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |