C24H27N5O2 — CID 51957434
1-methyl-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]-1-[(S)-phenyl(pyridin-2-yl)methyl]urea (PubChem CID 51957434) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-methyl-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]-1-[(S)-phenyl(pyridin-2-yl)methyl]urea.
| Compound Name | 1-methyl-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]-1-[(S)-phenyl(pyridin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 51957434 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1-methyl-3-[(6-morpholin-4-yl-3-pyridinyl)methyl]-1-[(S)-phenyl(pyridin-2-yl)methyl]urea |
| SMILES | CN(C(=O)NCc1ccc(N2CCOCC2)nc1)[C@@H](c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C24H27N5O2/c1-28(23(20-7-3-2-4-8-20)21-9-5-6-12-25-21)24(30)27-18-19-10-11-22(26-17-19)29-13-15-31-16-14-29/h2-12,17,23H,13-16,18H2,1H3,(H,27,30)/t23-/m0/s1 |
| InChIKey | NBTFDWZKHTYPNY-QHCPKHFHSA-N |
| XLogP | 3.24 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |