C13H18F6N6O — CID 4296765
4-[(1,1,1,3,3,3-hexafluoropropan-2-yl)oxy]-6-(piperazin-1-yl)-N-(propan-2-yl)-1,3,5-triazin-2-amine (PubChem CID 4296765) has the molecular formula C13H18F6N6O and a molecular weight of 388.31 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-1-yl-N-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-[(1,1,1,3,3,3-hexafluoropropan-2-yl)oxy]-6-(piperazin-1-yl)-N-(propan-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 4296765 |
| Molecular Formula | C13H18F6N6O |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-1-yl-N-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)NC1=NC(=NC(=N1)OC(C(F)(F)F)C(F)(F)F)N2CCNCC2 |
| InChI | InChI=1S/C13H18F6N6O/c1-7(2)21-9-22-10(25-5-3-20-4-6-25)24-11(23-9)26-8(12(14,15)16)13(17,18)19/h7-8,20H,3-6H2,1-2H3,(H,21,22,23,24) |
| InChIKey | UENVCLRBKYXEBS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | 428 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |