C24H24N2O5 — CID 42969662
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 42969662) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 42969662 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)c1ccc2[nH]c3c(c2c1)CC(C)CC3 |
| InChI | InChI=1S/C24H24N2O5/c1-14-7-9-19-17(11-14)18-12-15(8-10-20(18)25-19)24(29)31-13-22(27)26-23(28)16-5-3-4-6-21(16)30-2/h3-6,8,10,12,14,25H,7,9,11,13H2,1-2H3,(H,26,27,28) |
| InChIKey | JTRVSFLBQSHQGJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|