C20H20N2O2 — CID 43009061
pyridin-2-ylmethyl 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 43009061) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is pyridin-2-ylmethyl 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | pyridin-2-ylmethyl 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 43009061 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | pyridin-2-ylmethyl 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | CC1CCc2[nH]c3ccc(C(=O)OCc4ccccn4)cc3c2C1 |
| InChI | InChI=1S/C20H20N2O2/c1-13-5-7-18-16(10-13)17-11-14(6-8-19(17)22-18)20(23)24-12-15-4-2-3-9-21-15/h2-4,6,8-9,11,13,22H,5,7,10,12H2,1H3 |
| InChIKey | MDLQSIQRNOSCJA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|