C20H22N2O7S — CID 42971861
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-(furan-2-carbonylamino)propanoate (PubChem CID 42971861) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-(furan-2-carbonylamino)propanoate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 42971861 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-(furan-2-carbonylamino)propanoate |
| SMILES | CC(NC(=O)c1ccco1)C(=O)OCC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H22N2O7S/c1-14(21-19(24)18-5-4-12-28-18)20(25)29-13-17(23)15-6-8-16(9-7-15)30(26,27)22-10-2-3-11-22/h4-9,12,14H,2-3,10-11,13H2,1H3,(H,21,24) |
| InChIKey | CQURNKBOSALIII-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |