C21H21ClFN3O2S — CID 42976818
3-[2-(3-chlorophenoxy)ethylsulfanyl]-5-(4-fluorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazole (PubChem CID 42976818) has the molecular formula C21H21ClFN3O2S and a molecular weight of 433.94 g/mol. Its IUPAC name is 3-[2-(3-chlorophenoxy)ethylsulfanyl]-5-(4-fluorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazole.
| Compound Name | 3-[2-(3-chlorophenoxy)ethylsulfanyl]-5-(4-fluorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 42976818 |
| Molecular Formula | C21H21ClFN3O2S |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 3-[2-(3-chlorophenoxy)ethylsulfanyl]-5-(4-fluorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazole |
| SMILES | Fc1ccc(-c2nnc(SCCOc3cccc(Cl)c3)n2CC2CCCO2)cc1 |
| InChI | InChI=1S/C21H21ClFN3O2S/c22-16-3-1-4-18(13-16)28-11-12-29-21-25-24-20(15-6-8-17(23)9-7-15)26(21)14-19-5-2-10-27-19/h1,3-4,6-9,13,19H,2,5,10-12,14H2 |
| InChIKey | DTZVDGGNCOKPIK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|