C23H19ClN4O4S — CID 42979221
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 42979221) has the molecular formula C23H19ClN4O4S and a molecular weight of 482.95 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 42979221 |
| Molecular Formula | C23H19ClN4O4S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c2sc(C(=O)OCC(=O)NNC(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C23H19ClN4O4S/c1-14-17-11-19(33-22(17)28(27-14)12-16-9-5-6-10-18(16)24)23(31)32-13-20(29)25-26-21(30)15-7-3-2-4-8-15/h2-11H,12-13H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | DTTBRYUDZYWSOO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|