C22H17Cl3N2O3S — CID 5108238
2-(2,4-dichlorophenoxy)ethyl 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 5108238) has the molecular formula C22H17Cl3N2O3S and a molecular weight of 495.82 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 5108238 |
| Molecular Formula | C22H17Cl3N2O3S |
| Molecular Weight | 495.82 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c2sc(C(=O)OCCOc3ccc(Cl)cc3Cl)cc12 |
| InChI | InChI=1S/C22H17Cl3N2O3S/c1-13-16-11-20(22(28)30-9-8-29-19-7-6-15(23)10-18(19)25)31-21(16)27(26-13)12-14-4-2-3-5-17(14)24/h2-7,10-11H,8-9,12H2,1H3 |
| InChIKey | JTEKVWGUHAOKJH-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.82 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|