C24H29ClN2O4 — CID 42980359
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 42980359) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 42980359 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)C(c3ccc(Cl)cc3)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H29ClN2O4/c1-17(2)23(18-4-6-19(25)7-5-18)24(29)31-16-22(28)27-14-12-26(13-15-27)20-8-10-21(30-3)11-9-20/h4-11,17,23H,12-16H2,1-3H3 |
| InChIKey | CVMKOXJIRLIACM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|