C25H30ClN3O5 — CID 25162657
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 25162657) has the molecular formula C25H30ClN3O5 and a molecular weight of 487.98 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 25162657 |
| Molecular Formula | C25H30ClN3O5 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)[C@@H](NC(=O)c3ccccc3Cl)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H30ClN3O5/c1-17(2)23(27-24(31)20-6-4-5-7-21(20)26)25(32)34-16-22(30)29-14-12-28(13-15-29)18-8-10-19(33-3)11-9-18/h4-11,17,23H,12-16H2,1-3H3,(H,27,31)/t23-/m0/s1 |
| InChIKey | ITAAZRBIASMQTI-QHCPKHFHSA-N |
| XLogP | 2.99 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|