C21H22ClNO4S — CID 42982229
[2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 3-(2-chlorophenyl)sulfanylpropanoate (PubChem CID 42982229) has the molecular formula C21H22ClNO4S and a molecular weight of 419.93 g/mol. Its IUPAC name is [2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 3-(2-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 3-(2-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 42982229 |
| Molecular Formula | C21H22ClNO4S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 3-(2-chlorophenyl)sulfanylpropanoate |
| SMILES | CC(=O)C(Cc1ccccc1)NC(=O)COC(=O)CCSc1ccccc1Cl |
| InChI | InChI=1S/C21H22ClNO4S/c1-15(24)18(13-16-7-3-2-4-8-16)23-20(25)14-27-21(26)11-12-28-19-10-6-5-9-17(19)22/h2-10,18H,11-14H2,1H3,(H,23,25) |
| InChIKey | WRWMRBGPCROTPK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |