C24H26N2O6 — CID 42983235
(2-methoxy-5-nitrophenyl)methyl 2-(2,3-dihydroindole-1-carbonyl)cyclohexane-1-carboxylate (PubChem CID 42983235) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is (2-methoxy-5-nitrophenyl)methyl 2-(2,3-dihydroindole-1-carbonyl)cyclohexane-1-carboxylate.
| Compound Name | (2-methoxy-5-nitrophenyl)methyl 2-(2,3-dihydroindole-1-carbonyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 42983235 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (2-methoxy-5-nitrophenyl)methyl 2-(2,3-dihydroindole-1-carbonyl)cyclohexane-1-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1COC(=O)C1CCCCC1C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C24H26N2O6/c1-31-22-11-10-18(26(29)30)14-17(22)15-32-24(28)20-8-4-3-7-19(20)23(27)25-13-12-16-6-2-5-9-21(16)25/h2,5-6,9-11,14,19-20H,3-4,7-8,12-13,15H2,1H3 |
| InChIKey | GNHYCXHQAQUPKZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|