C26H30N4O4 — CID 46563046
[2-(2,3-dihydroindole-1-carbonyl)cyclohexyl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 46563046) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is [2-(2,3-dihydroindole-1-carbonyl)cyclohexyl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(2,3-dihydroindole-1-carbonyl)cyclohexyl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46563046 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | [2-(2,3-dihydroindole-1-carbonyl)cyclohexyl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCCCC1C(=O)N1CCc2ccccc21)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C26H30N4O4/c31-25(28-17-15-27(16-18-28)23-11-5-6-12-24(23)30(33)34)20-8-2-3-9-21(20)26(32)29-14-13-19-7-1-4-10-22(19)29/h1,4-7,10-12,20-21H,2-3,8-9,13-18H2 |
| InChIKey | QUWIQZGQUYCCKU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|