C24H33N3O2 — CID 95296662
[(9aR)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-[(1R,2S)-2-(2,3-dihydroindole-1-carbonyl)cyclohexyl]methanone (PubChem CID 95296662) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is [(9aR)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-[(1R,2S)-2-(2,3-dihydroindole-1-carbonyl)cyclohexyl]methanone.
| Compound Name | [(9aR)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-[(1R,2S)-2-(2,3-dihydroindole-1-carbonyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 95296662 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | [(9aR)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-[(1R,2S)-2-(2,3-dihydroindole-1-carbonyl)cyclohexyl]methanone |
| SMILES | O=C([C@@H]1CCCC[C@@H]1C(=O)N1CCc2ccccc21)N1CCCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C24H33N3O2/c28-23(26-15-6-14-25-13-5-8-19(25)17-26)20-9-2-3-10-21(20)24(29)27-16-12-18-7-1-4-11-22(18)27/h1,4,7,11,19-21H,2-3,5-6,8-10,12-17H2/t19-,20-,21+/m1/s1 |
| InChIKey | NBHQIJSEWLMMLP-NJYVYQBISA-N |
| XLogP | 3.08 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |