C20H21ClN2O6 — CID 42983781
[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 42983781) has the molecular formula C20H21ClN2O6 and a molecular weight of 420.85 g/mol. Its IUPAC name is [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42983781 |
| Molecular Formula | C20H21ClN2O6 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)OC(C)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C20H21ClN2O6/c1-12(20(25)23-18-7-6-14(21)11-22-18)29-19(24)8-5-13-9-16(27-3)17(28-4)10-15(13)26-2/h5-12H,1-4H3,(H,22,23,25)/b8-5+ |
| InChIKey | BLABKBBZGZGHDP-VMPITWQZSA-N |
| XLogP | 3.34 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|