C18H15ClF2N2O4 — CID 7996781
[(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 7996781) has the molecular formula C18H15ClF2N2O4 and a molecular weight of 396.78 g/mol. Its IUPAC name is [(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7996781 |
| Molecular Formula | C18H15ClF2N2O4 |
| Molecular Weight | 396.78 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(OC(F)F)cc1)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H15ClF2N2O4/c1-11(17(25)23-15-8-5-13(19)10-22-15)26-16(24)9-4-12-2-6-14(7-3-12)27-18(20)21/h2-11,18H,1H3,(H,22,23,25)/b9-4+/t11-/m0/s1 |
| InChIKey | QDPIWADXQPIQEH-VKJYCEFSSA-N |
| XLogP | 3.92 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|