C19H16ClF2NO4 — CID 4211254
[1-(3-chloroanilino)-1-oxopropan-2-yl] 3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 4211254) has the molecular formula C19H16ClF2NO4 and a molecular weight of 395.79 g/mol. Its IUPAC name is [1-(3-chloroanilino)-1-oxopropan-2-yl] 3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [1-(3-chloroanilino)-1-oxopropan-2-yl] 3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 4211254 |
| Molecular Formula | C19H16ClF2NO4 |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | [1-(3-chloroanilino)-1-oxopropan-2-yl] 3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1ccc(OC(F)F)cc1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H16ClF2NO4/c1-12(18(25)23-15-4-2-3-14(20)11-15)26-17(24)10-7-13-5-8-16(9-6-13)27-19(21)22/h2-12,19H,1H3,(H,23,25) |
| InChIKey | SMPJPDAOUTWUCD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|