C23H25F2NO4 — CID 7996760
[(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 7996760) has the molecular formula C23H25F2NO4 and a molecular weight of 417.45 g/mol. Its IUPAC name is [(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7996760 |
| Molecular Formula | C23H25F2NO4 |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)[C@@H](C)OC(=O)/C=C/c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C23H25F2NO4/c1-4-15(2)19-7-5-6-8-20(19)26-22(28)16(3)29-21(27)14-11-17-9-12-18(13-10-17)30-23(24)25/h5-16,23H,4H2,1-3H3,(H,26,28)/b14-11+/t15-,16+/m0/s1 |
| InChIKey | NNGYVLUMODMOAM-QNHDLBPPSA-N |
| XLogP | 5.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|