C23H18N2O5 — CID 42984081
[1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)benzoate (PubChem CID 42984081) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is [1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)benzoate.
| Compound Name | [1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 42984081 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)benzoate |
| SMILES | CC(OC(=O)c1ccccc1NC(=O)c1ccco1)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H18N2O5/c1-14(21(26)17-13-24-18-9-4-2-7-15(17)18)30-23(28)16-8-3-5-10-19(16)25-22(27)20-11-6-12-29-20/h2-14,24H,1H3,(H,25,27) |
| InChIKey | LTMGEMDIENEVHK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |