C22H20N2O5 — CID 2600932
[(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)benzoate (PubChem CID 2600932) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is [(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)benzoate.
| Compound Name | [(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 2600932 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1NC(=O)c1ccco1)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O5/c1-15(21(26)24(2)16-9-4-3-5-10-16)29-22(27)17-11-6-7-12-18(17)23-20(25)19-13-8-14-28-19/h3-15H,1-2H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | ISQPZHCXBFQSQI-OAHLLOKOSA-N |
| XLogP | 3.74 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |