C27H22N2O5 — CID 16533705
[2-(4-methylanilino)-2-oxo-1-phenylethyl] 2-(furan-2-carbonylamino)benzoate (PubChem CID 16533705) has the molecular formula C27H22N2O5 and a molecular weight of 454.48 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxo-1-phenylethyl] 2-(furan-2-carbonylamino)benzoate.
| Compound Name | [2-(4-methylanilino)-2-oxo-1-phenylethyl] 2-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 16533705 |
| Molecular Formula | C27H22N2O5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [2-(4-methylanilino)-2-oxo-1-phenylethyl] 2-(furan-2-carbonylamino)benzoate |
| SMILES | Cc1ccc(NC(=O)C(OC(=O)c2ccccc2NC(=O)c2ccco2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N2O5/c1-18-13-15-20(16-14-18)28-26(31)24(19-8-3-2-4-9-19)34-27(32)21-10-5-6-11-22(21)29-25(30)23-12-7-17-33-23/h2-17,24H,1H3,(H,28,31)(H,29,30) |
| InChIKey | PHQRAFWXFLVPCV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |