C24H26N2O6 — CID 42985128
[1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 42985128) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 42985128 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)OC(C)C(=O)N(C)Cc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C24H26N2O6/c1-16(21(27)25(2)15-17-8-5-4-6-9-17)32-24(30)18-10-11-19-20(14-18)23(29)26(22(19)28)12-7-13-31-3/h4-6,8-11,14,16H,7,12-13,15H2,1-3H3 |
| InChIKey | HCWGNIASSFBOBU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|