C21H20ClNO5 — CID 7738478
[(1S)-1-(2-chlorophenyl)ethyl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7738478) has the molecular formula C21H20ClNO5 and a molecular weight of 401.85 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7738478 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)O[C@@H](C)c3ccccc3Cl)cc2C1=O |
| InChI | InChI=1S/C21H20ClNO5/c1-13(15-6-3-4-7-18(15)22)28-21(26)14-8-9-16-17(12-14)20(25)23(19(16)24)10-5-11-27-2/h3-4,6-9,12-13H,5,10-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | UAOVQTRYNYPRGE-ZDUSSCGKSA-N |
| XLogP | 3.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|