C22H26N4O4S2 — CID 42985887
3-[[4-benzyl-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol (PubChem CID 42985887) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 3-[[4-benzyl-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol.
| Compound Name | 3-[[4-benzyl-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 42985887 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-[[4-benzyl-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol |
| SMILES | O=S(=O)(c1cccc(-c2nnc(SCCCO)n2Cc2ccccc2)c1)N1CCOCC1 |
| InChI | InChI=1S/C22H26N4O4S2/c27-12-5-15-31-22-24-23-21(26(22)17-18-6-2-1-3-7-18)19-8-4-9-20(16-19)32(28,29)25-10-13-30-14-11-25/h1-4,6-9,16,27H,5,10-15,17H2 |
| InChIKey | WDAAAFHSOQGQTP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|