C18H21N5O3S2 — CID 7876797
3-[[5-(3-morpholin-4-ylsulfonylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanenitrile (PubChem CID 7876797) has the molecular formula C18H21N5O3S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-[[5-(3-morpholin-4-ylsulfonylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[5-(3-morpholin-4-ylsulfonylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 7876797 |
| Molecular Formula | C18H21N5O3S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 3-[[5-(3-morpholin-4-ylsulfonylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
| SMILES | C=CCn1c(SCCC#N)nnc1-c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H21N5O3S2/c1-2-8-23-17(20-21-18(23)27-13-4-7-19)15-5-3-6-16(14-15)28(24,25)22-9-11-26-12-10-22/h2-3,5-6,14H,1,4,8-13H2 |
| InChIKey | KFQOSBRWHJXFEU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|