C27H37N3O4 — CID 42988248
2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-methylpentanamide (PubChem CID 42988248) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-methylpentanamide.
| Compound Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 42988248 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-methylpentanamide |
| SMILES | COc1ccc(C(CNC(=O)C(CC(C)C)N2C(=O)C3CC=CCC3C2=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C27H37N3O4/c1-18(2)16-23(30-26(32)21-8-4-5-9-22(21)27(30)33)25(31)28-17-24(29-14-6-7-15-29)19-10-12-20(34-3)13-11-19/h4-5,10-13,18,21-24H,6-9,14-17H2,1-3H3,(H,28,31) |
| InChIKey | RKNQCULQUIQHCX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|