C24H32N2O6 — CID 55654259
N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide (PubChem CID 55654259) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide.
| Compound Name | N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 55654259 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide |
| SMILES | COc1ccc(OC)c(C(O)CNC(=O)C(CC(C)C)N2C(=O)C3CC=CCC3C2=O)c1 |
| InChI | InChI=1S/C24H32N2O6/c1-14(2)11-19(26-23(29)16-7-5-6-8-17(16)24(26)30)22(28)25-13-20(27)18-12-15(31-3)9-10-21(18)32-4/h5-6,9-10,12,14,16-17,19-20,27H,7-8,11,13H2,1-4H3,(H,25,28) |
| InChIKey | ZTPIMLLDKXJLCJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|