C20H25ClN2O4S — CID 42990397
3-(4-chlorophenyl)sulfonyl-N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]propanamide (PubChem CID 42990397) has the molecular formula C20H25ClN2O4S and a molecular weight of 424.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 42990397 |
| Molecular Formula | C20H25ClN2O4S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(C(CNC(=O)CCS(=O)(=O)c2ccc(Cl)cc2)N(C)C)cc1 |
| InChI | InChI=1S/C20H25ClN2O4S/c1-23(2)19(15-4-8-17(27-3)9-5-15)14-22-20(24)12-13-28(25,26)18-10-6-16(21)7-11-18/h4-11,19H,12-14H2,1-3H3,(H,22,24) |
| InChIKey | ZIYQOAMNTXLWDL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |