C17H28N2O4S — CID 110621812
N-[2-(diethylamino)-2-(4-methoxyphenyl)ethyl]-3-methylsulfonylpropanamide (PubChem CID 110621812) has the molecular formula C17H28N2O4S and a molecular weight of 356.49 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-(4-methoxyphenyl)ethyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[2-(diethylamino)-2-(4-methoxyphenyl)ethyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 110621812 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-[2-(diethylamino)-2-(4-methoxyphenyl)ethyl]-3-methylsulfonylpropanamide |
| SMILES | CCN(CC)C(CNC(=O)CCS(C)(=O)=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H28N2O4S/c1-5-19(6-2)16(14-7-9-15(23-3)10-8-14)13-18-17(20)11-12-24(4,21)22/h7-10,16H,5-6,11-13H2,1-4H3,(H,18,20) |
| InChIKey | QBGJTYXJAHHKII-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |