C18H30N2O3S — CID 110302652
N-[2-(diethylamino)-2-(4-methoxyphenyl)ethyl]cyclopentanesulfonamide (PubChem CID 110302652) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-(4-methoxyphenyl)ethyl]cyclopentanesulfonamide.
| Compound Name | N-[2-(diethylamino)-2-(4-methoxyphenyl)ethyl]cyclopentanesulfonamide |
|---|---|
| PubChem CID | 110302652 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | N-[2-(diethylamino)-2-(4-methoxyphenyl)ethyl]cyclopentanesulfonamide |
| SMILES | CCN(CC)C(CNS(=O)(=O)C1CCCC1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H30N2O3S/c1-4-20(5-2)18(15-10-12-16(23-3)13-11-15)14-19-24(21,22)17-8-6-7-9-17/h10-13,17-19H,4-9,14H2,1-3H3 |
| InChIKey | FWGUAMZSRWQIQH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |