C22H22N4O4S — CID 42990625
2-(3-cyclopentyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)-N-(3-nitrophenyl)acetamide (PubChem CID 42990625) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-(3-cyclopentyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(3-cyclopentyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 42990625 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-(3-cyclopentyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(CC1S/C(=N\c2ccccc2)N(C2CCCC2)C1=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22N4O4S/c27-20(23-16-9-6-12-18(13-16)26(29)30)14-19-21(28)25(17-10-4-5-11-17)22(31-19)24-15-7-2-1-3-8-15/h1-3,6-9,12-13,17,19H,4-5,10-11,14H2,(H,23,27)/b24-22- |
| InChIKey | DSPOWYSLIYNMHE-GYHWCHFESA-N |
| XLogP | 4.50 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|