C19H18ClFN2O3S2 — CID 42996715
2-methoxyethyl 3-(3-chloro-4-fluorophenyl)-4-methyl-2-sulfanylidene-6-thiophen-3-yl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42996715) has the molecular formula C19H18ClFN2O3S2 and a molecular weight of 440.95 g/mol. Its IUPAC name is 2-methoxyethyl 3-(3-chloro-4-fluorophenyl)-4-methyl-2-sulfanylidene-6-thiophen-3-yl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 3-(3-chloro-4-fluorophenyl)-4-methyl-2-sulfanylidene-6-thiophen-3-yl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42996715 |
| Molecular Formula | C19H18ClFN2O3S2 |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 2-methoxyethyl 3-(3-chloro-4-fluorophenyl)-4-methyl-2-sulfanylidene-6-thiophen-3-yl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(c2ccc(F)c(Cl)c2)C(=S)NC1c1ccsc1 |
| InChI | InChI=1S/C19H18ClFN2O3S2/c1-11-16(18(24)26-7-6-25-2)17(12-5-8-28-10-12)22-19(27)23(11)13-3-4-15(21)14(20)9-13/h3-5,8-10,17H,6-7H2,1-2H3,(H,22,27) |
| InChIKey | WYEJNQUKMWWZJK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|