C16H18F2N2O4 — CID 8862926
2-methoxyethyl (6S)-6-(3,4-difluorophenyl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 8862926) has the molecular formula C16H18F2N2O4 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-methoxyethyl (6S)-6-(3,4-difluorophenyl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl (6S)-6-(3,4-difluorophenyl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8862926 |
| Molecular Formula | C16H18F2N2O4 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-methoxyethyl (6S)-6-(3,4-difluorophenyl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C)C(=O)N[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H18F2N2O4/c1-9-13(15(21)24-7-6-23-3)14(19-16(22)20(9)2)10-4-5-11(17)12(18)8-10/h4-5,8,14H,6-7H2,1-3H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | JOLVRHHDYYDPLD-AWEZNQCLSA-N |
| XLogP | 2.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|