C14H17BrN2O4S — CID 8862895
2-methoxyethyl (6R)-6-(4-bromothiophen-2-yl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 8862895) has the molecular formula C14H17BrN2O4S and a molecular weight of 389.27 g/mol. Its IUPAC name is 2-methoxyethyl (6R)-6-(4-bromothiophen-2-yl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl (6R)-6-(4-bromothiophen-2-yl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8862895 |
| Molecular Formula | C14H17BrN2O4S |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 2-methoxyethyl (6R)-6-(4-bromothiophen-2-yl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C)C(=O)N[C@H]1c1cc(Br)cs1 |
| InChI | InChI=1S/C14H17BrN2O4S/c1-8-11(13(18)21-5-4-20-3)12(16-14(19)17(8)2)10-6-9(15)7-22-10/h6-7,12H,4-5H2,1-3H3,(H,16,19)/t12-/m0/s1 |
| InChIKey | BNFJBHGHMPMMRF-LBPRGKRZSA-N |
| XLogP | 2.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|