C19H25N3O5 — CID 5236100
2-methoxyethyl 3,4-dimethyl-2-oxo-6-[4-(propanoylamino)phenyl]-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 5236100) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-methoxyethyl 3,4-dimethyl-2-oxo-6-[4-(propanoylamino)phenyl]-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 3,4-dimethyl-2-oxo-6-[4-(propanoylamino)phenyl]-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 5236100 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-methoxyethyl 3,4-dimethyl-2-oxo-6-[4-(propanoylamino)phenyl]-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCC(=O)Nc1ccc(C2NC(=O)N(C)C(C)=C2C(=O)OCCOC)cc1 |
| InChI | InChI=1S/C19H25N3O5/c1-5-15(23)20-14-8-6-13(7-9-14)17-16(18(24)27-11-10-26-4)12(2)22(3)19(25)21-17/h6-9,17H,5,10-11H2,1-4H3,(H,20,23)(H,21,25) |
| InChIKey | CFJVMPBGTZCTLD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|