C25H29N3O3S2 — CID 4299858
3-cyclopentyl-5-[[4-(2,6-dimethylmorpholin-4-yl)-1-methyl-2-oxoquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4299858) has the molecular formula C25H29N3O3S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 3-cyclopentyl-5-[[4-(2,6-dimethylmorpholin-4-yl)-1-methyl-2-oxoquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclopentyl-5-[[4-(2,6-dimethylmorpholin-4-yl)-1-methyl-2-oxoquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4299858 |
| Molecular Formula | C25H29N3O3S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 3-cyclopentyl-5-[[4-(2,6-dimethylmorpholin-4-yl)-1-methyl-2-oxoquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC1CN(c2c(C=C3SC(=S)N(C4CCCC4)C3=O)c(=O)n(C)c3ccccc23)CC(C)O1 |
| InChI | InChI=1S/C25H29N3O3S2/c1-15-13-27(14-16(2)31-15)22-18-10-6-7-11-20(18)26(3)23(29)19(22)12-21-24(30)28(25(32)33-21)17-8-4-5-9-17/h6-7,10-12,15-17H,4-5,8-9,13-14H2,1-3H3 |
| InChIKey | GYJUHUAEIGFREE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|