C26H31N3O3S2 — CID 5136085
3-cyclopentyl-5-[[4-(2,6-dimethylmorpholin-4-yl)-1-ethyl-2-oxoquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5136085) has the molecular formula C26H31N3O3S2 and a molecular weight of 497.69 g/mol. Its IUPAC name is 3-cyclopentyl-5-[[4-(2,6-dimethylmorpholin-4-yl)-1-ethyl-2-oxoquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclopentyl-5-[[4-(2,6-dimethylmorpholin-4-yl)-1-ethyl-2-oxoquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5136085 |
| Molecular Formula | C26H31N3O3S2 |
| Molecular Weight | 497.69 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 3-cyclopentyl-5-[[4-(2,6-dimethylmorpholin-4-yl)-1-ethyl-2-oxoquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCn1c(=O)c(C=C2SC(=S)N(C3CCCC3)C2=O)c(N2CC(C)OC(C)C2)c2ccccc21 |
| InChI | InChI=1S/C26H31N3O3S2/c1-4-28-21-12-8-7-11-19(21)23(27-14-16(2)32-17(3)15-27)20(24(28)30)13-22-25(31)29(26(33)34-22)18-9-5-6-10-18/h7-8,11-13,16-18H,4-6,9-10,14-15H2,1-3H3 |
| InChIKey | ZVLLGAFNAMDPCF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.69 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|